| id | C00041997 |
|---|---|
| Name | (+)-Hexylitaconic acid |
| CAS RN | 94513-51-6 |
| Standard InChI | InChI=1S/C11H18O4/c1-3-4-5-6-7-9(11(14)15)8(2)10(12)13/h9H,2-7H2,1H3,(H,12,13)(H,14,15)/t9-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H18O4/c1-3-4-5-6-7-9(11(14)15)8(2)10(12)13/h9H,2-7H2,1H3,(H,12,13)(H,14,15) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4730 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL199341 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Penicillium striatisporum | 72154 | Aspergillaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q00987 | E3 ubiquitin-protein ligase Mdm2 | Other nuclear protein | CHEMBL199341 |
CHEMBL869434
(1)
|
1 / 5 |