| id | C00042009 |
|---|---|
| Name | (3'S)-Stemofolenol / (+)-(3'S)-Stemofolenol |
| CAS RN | 872598-64-6 |
| Standard InChI | InChI=1S/C22H27NO6/c1-10(24)5-7-21-14-6-8-23(21)13-9-15(21)28-22(14)16(13)11(2)18(29-22)19-17(26-4)12(3)20(25)27-19/h5,7,10-11,13-16,24H,6,8-9H2,1-4H3/b7-5+,19-18-/t10-,11-,13?,14+,15-,16?,21-,22?/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H27NO6/c1-10(24)5-7-21-14-6-8-23(21)13-9-15(21)28-22(14)16(13)11(2)18(29-22)19-17(26-4)12(3)20(25)27-19/h5,7,10-11,13-16,24H,6,8-9H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 372 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1083452 CHEMBL1084855 CHEMBL2068680 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Stemonaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stemona sp. | 85281 | Stemonaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL2068680 |
CHEMBL1031199
(2)
|
1 / 0 |