| id | C00042063 |
|---|---|
| Name | 1-Monopalmitin |
| CAS RN | 542-44-9 |
| Standard InChI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 627 |
| By standard InChI | CHEMBL1078140 |
|---|---|
| By standard InChI Main Layer | CHEMBL1078140 |
| By LinkDB |
|---|
| By CAS RN | C027735 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Morinda citrifolia L | 43521 | Rubiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL1078140 |
CHEMBL1106811
(1)
|
0 / 0 |