| id | C00042389 |
|---|---|
| Name | Cimipronidine / (+)-Cimipronidine |
| CAS RN | 865266-71-3 |
| Standard InChI | InChI=1S/C7H13N3O2/c8-7(9)10-3-1-2-5(10)4-6(11)12/h5H,1-4H2,(H3,8,9)(H,11,12) |
| Standard InChI (Main Layer) | InChI=1S/C7H13N3O2/c8-7(9)10-3-1-2-5(10)4-6(11)12/h5H,1-4H2,(H3,8,9)(H,11,12) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5932 |
| By standard InChI | CHEMBL485803 |
|---|---|
| By standard InChI Main Layer | CHEMBL485803 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Ranunculaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cimicifuga racemosa | 64040 | Ranunculaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P34969 | 5-hydroxytryptamine receptor 7 | Serotonin receptor | CHEMBL485803 |
CHEMBL998216
(1)
|
0 / 0 |