| id | C00042431 |
|---|---|
| Name | Cyclo(phenylalanyl-prolyl) |
| CAS RN | 14705-60-3 |
| Standard InChI | InChI=1S/C14H16N2O2/c17-13-12-7-4-8-16(12)14(18)11(15-13)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,15,17) |
| Standard InChI (Main Layer) | InChI=1S/C14H16N2O2/c17-13-12-7-4-8-16(12)14(18)11(15-13)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,15,17) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2431 |
| By standard InChI | CHEMBL1990465 |
|---|---|
| By standard InChI Main Layer | CHEMBL462452 CHEMBL453184 CHEMBL499995 CHEMBL512845 CHEMBL1879458 CHEMBL1990465 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. NPS008187 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL453184 CHEMBL512845 |
CHEMBL941113
(2)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL512845 CHEMBL1879458 |
CHEMBL1794483
(2)
|
0 / 0 |