| id | C00004257 |
|---|---|
| Name | 5,6,7,2'-Tetrahydroxyflavone 7-glucuronide |
| CAS RN | 119152-49-7 |
| Standard InChI | InChI=1S/C21H18O12/c22-8-4-2-1-3-7(8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-22,24-28H,(H,29,30)/t16-,17-,18?,19?,21+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H18O12/c22-8-4-2-1-3-7(8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-22,24-28H,(H,29,30) |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL512609 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Scutellaria ikonnikovii | 4139 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P34969 | 5-hydroxytryptamine receptor 7 | Serotonin receptor | CHEMBL512609 |
CHEMBL991220
(1)
|
0 / 0 |