| id | C00042759 |
|---|---|
| Name | N,N-Dimethylphenethylamine |
| CAS RN | 1126-71-2 |
| Standard InChI | InChI=1S/C10H15N/c1-11(2)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C10H15N/c1-11(2)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8159 |
| By standard InChI | CHEMBL46278 |
|---|---|
| By standard InChI Main Layer | CHEMBL46278 |
| By LinkDB |
|---|
| By CAS RN | C043554 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acacia rigidula Benth. | 205076 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q96RJ0 | Trace amine-associated receptor 1 | Trace amine receptor | CHEMBL46278 |
CHEMBL989986
(1)
CHEMBL989987
(1)
CHEMBL989988 (1) CHEMBL989989 (1) |
0 / 0 |