| id | C00042852 |
|---|---|
| Name | p-Hydroxyamphetamine |
| CAS RN | 103-86-6 |
| Standard InChI | InChI=1S/C9H13NO/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5,7,11H,6,10H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C9H13NO/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5,7,11H,6,10H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4773 |
| By standard InChI | CHEMBL1546 |
|---|---|
| By standard InChI Main Layer | CHEMBL1546 CHEMBL1230845 CHEMBL1927024 |
| By LinkDB |
|---|
| By CAS RN | D010136 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acacia rigidula Benth. | 205076 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL1546 |
CHEMBL947944
(1)
CHEMBL947945
(1)
|
0 / 0 |
| Q96RJ0 | Trace amine-associated receptor 1 | Trace amine receptor | CHEMBL1230845 CHEMBL1927024 |
CHEMBL1930561
(2)
|
0 / 0 |