| id | C00042870 |
|---|---|
| Name | Ptilocaulin |
| CAS RN | 78777-02-3 |
| Standard InChI | InChI=1S/C15H25N3/c1-3-4-5-11-9(2)8-10-6-7-12-13(10)14(11)18-15(16)17-12/h9-10,12-13H,3-8H2,1-2H3,(H3,16,17,18)/t9-,10-,12-,13+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H25N3/c1-3-4-5-11-9(2)8-10-6-7-12-13(10)14(11)18-15(16)17-12/h9-10,12-13H,3-8H2,1-2H3,(H3,16,17,18) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2222 |
| By standard InChI | CHEMBL454881 |
|---|---|
| By standard InChI Main Layer | CHEMBL454881 |
| By LinkDB |
|---|
| By CAS RN | C061200 |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Batzella sp. | ||||
| Monanchora unguifera |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL454881 |
CHEMBL965573
(1)
|
1 / 1 |