| id | C00043031 | 
|---|---|
| Name | Sterequinone G | 
| CAS RN | 871577-16-1 | 
| Standard InChI | InChI=1S/C20H18O4/c1-11(21)4-5-13-6-8-16-18(12(13)2)20(23)17-10-14(24-3)7-9-15(17)19(16)22/h6-10H,4-5H2,1-3H3 | 
| Standard InChI (Main Layer) | InChI=1S/C20H18O4/c1-11(21)4-5-13-6-8-16-18(12(13)2)20(23)17-10-14(24-3)7-9-15(17)19(16)22/h6-10H,4-5H2,1-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3414 | 
| By standard InChI | CHEMBL465768 | 
|---|---|
| By standard InChI Main Layer | CHEMBL465768 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Bignoniaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Stereospermum personatum | 260324 | Bignoniaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL465768 | CHEMBL1036024
                        (1) | 1 / 1 |