| id | C00043032 |
|---|---|
| Name | Sterequinone I |
| CAS RN | 871577-18-3 |
| Standard InChI | InChI=1S/C20H18O4/c1-10-4-6-13-11(2)20(23)17(9-15(10)13)18(21)14-7-5-12(24-3)8-16(14)19(20)22/h5,7-9,23H,4,6H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H18O4/c1-10-4-6-13-11(2)20(23)17(9-15(10)13)18(21)14-7-5-12(24-3)8-16(14)19(20)22/h5,7-9,23H,4,6H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3382 |
| By standard InChI | CHEMBL465770 |
|---|---|
| By standard InChI Main Layer | CHEMBL465770 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Bignoniaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stereospermum personatum | 260324 | Bignoniaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL465770 |
CHEMBL1036024
(1)
|
1 / 1 |