| id | C00043141 |
|---|---|
| Name | 1-(3',5'-Dihydroxyphenoxy)-7-(2'',4'',trihydroxyphenoxy)-2,4,9-trihydroxydibenzo-1,4-dioxin |
| CAS RN | 662165-35-7 |
| Standard InChI | InChI=1S/C24H16O12/c25-9-1-10(26)3-12(2-9)34-22-17(31)8-18(32)23-24(22)36-21-16(30)6-13(7-19(21)35-23)33-20-14(28)4-11(27)5-15(20)29/h1-8,25-32H |
| Standard InChI (Main Layer) | InChI=1S/C24H16O12/c25-9-1-10(26)3-12(2-9)34-22-17(31)8-18(32)23-24(22)36-21-16(30)6-13(7-19(21)35-23)33-20-14(28)4-11(27)5-15(20)29/h1-8,25-32H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1893 |
| By standard InChI | CHEMBL456228 |
|---|---|
| By standard InChI Main Layer | CHEMBL456228 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Lessoniaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eisenia bicyclis | 6395 | Lessoniaceae | Eukaryota |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL456228 |
CHEMBL1117923
(2)
CHEMBL1117924
(1)
|
0 / 0 |