| id | C00043209 |
|---|---|
| Name | 5alpha-Carboxystrictosidine |
| CAS RN | 34371-11-4 |
| Standard InChI | InChI=1S/C28H34N2O11/c1-3-12-14(8-18-21-15(9-19(29-18)25(35)36)13-6-4-5-7-17(13)30-21)16(26(37)38-2)11-39-27(12)41-28-24(34)23(33)22(32)20(10-31)40-28/h3-7,11-12,14,18-20,22-24,27-34H,1,8-10H2,2H3,(H,35,36) |
| Standard InChI (Main Layer) | InChI=1S/C28H34N2O11/c1-3-12-14(8-18-21-15(9-19(29-18)25(35)36)13-6-4-5-7-17(13)30-21)16(26(37)38-2)11-39-27(12)41-28-24(34)23(33)22(32)20(10-31)40-28/h3-7,11-12,14,18-20,22-24,27-34H,1,8-10H2,2H3,(H,35,36) |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 618 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL503313 CHEMBL502463 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 4 |
| family name | count |
|---|---|
| Apocynaceae | 2 |
| Rubiaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chimarrhis turbinata | 128292 | Rubiaceae | asterids | Viridiplantae |
| Psychotria bahiensis | 96277 | Rubiaceae | asterids | Viridiplantae |
| Rhazya orientalis | 141609 | Apocynaceae | asterids | Viridiplantae |
| Rhazya stricta Decaisne. | 141608 | Apocynaceae | asterids | Viridiplantae |