| id | C00043363 | 
|---|---|
| Name | Cavipetin B | 
| CAS RN | 128530-03-0 | 
| Standard InChI | InChI=1S/C28H38O8/c1-21(10-6-12-23(3)18-19-35-27(33)16-14-25(29)30)8-5-9-22(2)11-7-13-24(4)20-36-28(34)17-15-26(31)32/h9-10,13-18H,5-8,11-12,19-20H2,1-4H3,(H,29,30)(H,31,32)/b16-14+,17-15+,21-10+,22-9+,23-18+,24-13+ | 
| Standard InChI (Main Layer) | InChI=1S/C28H38O8/c1-21(10-6-12-23(3)18-19-35-27(33)16-14-25(29)30)8-5-9-22(2)11-7-13-24(4)20-36-28(34)17-15-26(31)32/h9-10,13-18H,5-8,11-12,19-20H2,1-4H3,(H,29,30)(H,31,32) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6202 | 
| By standard InChI | CHEMBL469857 | 
|---|---|
| By standard InChI Main Layer | CHEMBL469857 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Gyrodontaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Boletinus cavipes | 85973 | Gyrodontaceae | Fungi | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL469857 | 
                        CHEMBL999197
                        (1)
                        CHEMBL999198
                        (1)
                         | 
                      1 / 1 |