| id | C00043363 |
|---|---|
| Name | Cavipetin B |
| CAS RN | 128530-03-0 |
| Standard InChI | InChI=1S/C28H38O8/c1-21(10-6-12-23(3)18-19-35-27(33)16-14-25(29)30)8-5-9-22(2)11-7-13-24(4)20-36-28(34)17-15-26(31)32/h9-10,13-18H,5-8,11-12,19-20H2,1-4H3,(H,29,30)(H,31,32)/b16-14+,17-15+,21-10+,22-9+,23-18+,24-13+ |
| Standard InChI (Main Layer) | InChI=1S/C28H38O8/c1-21(10-6-12-23(3)18-19-35-27(33)16-14-25(29)30)8-5-9-22(2)11-7-13-24(4)20-36-28(34)17-15-26(31)32/h9-10,13-18H,5-8,11-12,19-20H2,1-4H3,(H,29,30)(H,31,32) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6202 |
| By standard InChI | CHEMBL469857 |
|---|---|
| By standard InChI Main Layer | CHEMBL469857 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Gyrodontaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Boletinus cavipes | 85973 | Gyrodontaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL469857 |
CHEMBL999197
(1)
CHEMBL999198
(1)
|
1 / 1 |