| id | C00043569 |
|---|---|
| Name | Harman-3-carboxylic acid |
| CAS RN | 22329-38-0 |
| Standard InChI | InChI=1S/C13H10N2O2/c1-7-12-9(6-11(14-7)13(16)17)8-4-2-3-5-10(8)15-12/h2-6,15H,1H3,(H,16,17) |
| Standard InChI (Main Layer) | InChI=1S/C13H10N2O2/c1-7-12-9(6-11(14-7)13(16)17)8-4-2-3-5-10(8)15-12/h2-6,15H,1H3,(H,16,17) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1551 |
| By standard InChI | CHEMBL504850 |
|---|---|
| By standard InChI Main Layer | CHEMBL504850 |
| By LinkDB |
|---|
| By CAS RN | C026072 |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Apocynaceae | 1 |
| Rubiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aspidosperma exaltum | 84858 | Apocynaceae | asterids | Viridiplantae |
| Chimarrhis turbinata | 128292 | Rubiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL504850 |
CHEMBL1738312
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL504850 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL504850 |
CHEMBL1794401
(1)
|
0 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL504850 |
CHEMBL1737991
(1)
|
0 / 0 |