| id | C00043800 |
|---|---|
| Name | Oxyimperatorin |
| CAS RN | 35740-18-2 |
| Standard InChI | InChI=1S/C16H14O5/c1-16(2)11(21-16)8-19-15-13-10(5-6-18-13)7-9-3-4-12(17)20-14(9)15/h3-7,11H,8H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H14O5/c1-16(2)11(21-16)8-19-15-13-10(5-6-18-13)7-9-3-4-12(17)20-14(9)15/h3-7,11H,8H2,1-2H3 |
| Phytochemical cluster | No. 25 |
|---|---|
| KCF-S cluster | No. 2896 |
| By standard InChI | CHEMBL346814 |
|---|---|
| By standard InChI Main Layer | CHEMBL346814 CHEMBL500034 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Orixa japonica | 354507 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL500034 |
CHEMBL1936881
(1)
|
0 / 0 |
| P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL346814 |
CHEMBL1613829
(1)
|
0 / 0 |