| id | C00044279 |
|---|---|
| Name | Parthenocissin B / (-)-Parthenocissin B |
| CAS RN | 212513-36-5 |
| Standard InChI | InChI=1S/C42H32O9/c43-26-6-2-22(3-7-26)40-38(24-13-28(45)17-29(46)14-24)33(34-19-32(49)20-36(50)41(34)40)11-21-1-10-37-35(12-21)39(25-15-30(47)18-31(48)16-25)42(51-37)23-4-8-27(44)9-5-23/h1-20,38-40,42-50H/b33-11+/t38-,39+,40+,42-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C42H32O9/c43-26-6-2-22(3-7-26)40-38(24-13-28(45)17-29(46)14-24)33(34-19-32(49)20-36(50)41(34)40)11-21-1-10-37-35(12-21)39(25-15-30(47)18-31(48)16-25)42(51-37)23-4-8-27(44)9-5-23/h1-20,38-40,42-50H |
| Phytochemical cluster | No. 30 |
|---|---|
| KCF-S cluster | No. 163 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Parthenocissus quinquefolia | 3607 | Vitaceae | rosids | Viridiplantae |