| id | C00044498 |
|---|---|
| Name | Acronyculatin C |
| CAS RN | 578716-69-5 |
| Standard InChI | InChI=1S/C19H26O5/c1-10(2)7-8-13-17(22)16(14(21)9-11(3)4)18(23)15(12(5)20)19(13)24-6/h7,11,22-23H,8-9H2,1-6H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H26O5/c1-10(2)7-8-13-17(22)16(14(21)9-11(3)4)18(23)15(12(5)20)19(13)24-6/h7,11,22-23H,8-9H2,1-6H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5390 |
| By standard InChI | CHEMBL457947 |
|---|---|
| By standard InChI Main Layer | CHEMBL457947 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acronychia pedunculata | 354485 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL457947 |
CHEMBL985005
(1)
|
4 / 2 |