| id | C00044579 |
|---|---|
| Name | Briarellin D |
| CAS RN | 165171-24-4 |
| Standard InChI | InChI=1S/C24H36O6/c1-6-7-18(26)29-23(4)10-8-15-14(3)22(27)30-24(5)11-9-16(25)13(2)12-17-20(23)19(15)21(24)28-17/h14-17,19-21,25H,2,6-12H2,1,3-5H3 |
| Standard InChI (Main Layer) | InChI=1S/C24H36O6/c1-6-7-18(26)29-23(4)10-8-15-14(3)22(27)30-24(5)11-9-16(25)13(2)12-17-20(23)19(15)21(24)28-17/h14-17,19-21,25H,2,6-12H2,1,3-5H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 998 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL478567 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Briareidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Briareum polyanthes | 86543 | Briareidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06493 | Cyclin-dependent kinase 1 | Cdc2 | CHEMBL478567 |
CHEMBL1017575
(1)
|
0 / 0 |
| Q13972 | Ras-specific guanine nucleotide-releasing factor 1 | Unclassified protein | CHEMBL478567 |
CHEMBL1017576
(1)
|
0 / 0 |