| id | C00044801 | 
|---|---|
| Name | Hermitamide A | 
| CAS RN | 286012-62-2 | 
| Standard InChI | InChI=1S/C23H37NO2/c1-3-4-5-6-11-16-22(26-2)17-12-8-13-18-23(25)24-20-19-21-14-9-7-10-15-21/h7-10,12,14-15,22H,3-6,11,13,16-20H2,1-2H3,(H,24,25)/b12-8+/t22-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C23H37NO2/c1-3-4-5-6-11-16-22(26-2)17-12-8-13-18-23(25)24-20-19-21-14-9-7-10-15-21/h7-10,12,14-15,22H,3-6,11,13,16-20H2,1-2H3,(H,24,25) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3601 | 
| By standard InChI | CHEMBL498041 | 
|---|---|
| By standard InChI Main Layer | CHEMBL498041 CHEMBL1808199 CHEMBL1808200 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Lyngbya majuscula | 158786 | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q99250 | Sodium channel protein type 2 subunit alpha | SCN alpha, NaV1.x | CHEMBL498041 CHEMBL1808199 CHEMBL1808200 | CHEMBL1809308
                        (2)
                        CHEMBL1809309
                        (3) CHEMBL1809310 (3) | 2 / 2 |