| id | C00044801 |
|---|---|
| Name | Hermitamide A |
| CAS RN | 286012-62-2 |
| Standard InChI | InChI=1S/C23H37NO2/c1-3-4-5-6-11-16-22(26-2)17-12-8-13-18-23(25)24-20-19-21-14-9-7-10-15-21/h7-10,12,14-15,22H,3-6,11,13,16-20H2,1-2H3,(H,24,25)/b12-8+/t22-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H37NO2/c1-3-4-5-6-11-16-22(26-2)17-12-8-13-18-23(25)24-20-19-21-14-9-7-10-15-21/h7-10,12,14-15,22H,3-6,11,13,16-20H2,1-2H3,(H,24,25) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3601 |
| By standard InChI | CHEMBL498041 |
|---|---|
| By standard InChI Main Layer | CHEMBL498041 CHEMBL1808199 CHEMBL1808200 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lyngbya majuscula | 158786 | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q99250 | Sodium channel protein type 2 subunit alpha | SCN alpha, NaV1.x | CHEMBL498041 CHEMBL1808199 CHEMBL1808200 |
CHEMBL1809308
(2)
CHEMBL1809309
(3)
CHEMBL1809310 (3) |
2 / 2 |