| id | C00044802 | 
|---|---|
| Name | Hermitamide B / (-)-Hermitamide B | 
| CAS RN | 286012-63-3 | 
| Standard InChI | InChI=1S/C25H38N2O2/c1-3-4-5-6-8-13-22(29-2)14-9-7-10-17-25(28)26-19-18-21-20-27-24-16-12-11-15-23(21)24/h7,9,11-12,15-16,20,22,27H,3-6,8,10,13-14,17-19H2,1-2H3,(H,26,28)/b9-7+/t22-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C25H38N2O2/c1-3-4-5-6-8-13-22(29-2)14-9-7-10-17-25(28)26-19-18-21-20-27-24-16-12-11-15-23(21)24/h7,9,11-12,15-16,20,22,27H,3-6,8,10,13-14,17-19H2,1-2H3,(H,26,28) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3601 | 
| By standard InChI | CHEMBL524285 | 
|---|---|
| By standard InChI Main Layer | CHEMBL524285 CHEMBL1808201 CHEMBL1808202 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Lyngbya majuscula | 158786 | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q99250 | Sodium channel protein type 2 subunit alpha | SCN alpha, NaV1.x | CHEMBL524285 CHEMBL1808201 CHEMBL1808202 | CHEMBL1809308
                        (2)
                        CHEMBL1809309
                        (3) CHEMBL1809310 (3) | 2 / 2 |