id | C00044866 |
---|---|
Name | Leucettamol A / (-)-Leucettamol A |
CAS RN | 151124-32-2 |
Standard InChI | InChI=1S/C30H52N2O2/c1-27(31)29(33)25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-30(34)28(2)32/h3,5-6,8-9,11-12,14-15,17,21,23,27-30,33-34H,4,7,10,13,16,18-20,22,24-26,31-32H2,1-2H3/b5-3-,8-6-,11-9-,14-12-,17-15-,23-21-/t27-,28-,29+,30+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C30H52N2O2/c1-27(31)29(33)25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-30(34)28(2)32/h3,5-6,8-9,11-12,14-15,17,21,23,27-30,33-34H,4,7,10,13,16,18-20,22,24-26,31-32H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 2997 |
By standard InChI | CHEMBL465243 |
---|---|
By standard InChI Main Layer | CHEMBL465243 |
By LinkDB |
---|
By CAS RN | C080227 |
---|
class name | count |
---|
family name | count |
---|---|
Leucettidae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Leucetta sp. | 81546 | Leucettidae | Metazoa |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P61088 | Ubiquitin-conjugating enzyme E2 N | Enzyme | CHEMBL465243 |
CHEMBL1013729
(1)
CHEMBL1013730
(1)
|
0 / 0 |