id | C00045068 |
---|---|
Name | Scytonemin |
CAS RN | 152075-98-4 |
Standard InChI | InChI=1S/C36H20N2O4/c39-21-13-9-19(10-14-21)17-25-33-29(23-5-1-3-7-27(23)37-33)31(35(25)41)32-30-24-6-2-4-8-28(24)38-34(30)26(36(32)42)18-20-11-15-22(40)16-12-20/h1-18,39-40H |
Standard InChI (Main Layer) | InChI=1S/C36H20N2O4/c39-21-13-9-19(10-14-21)17-25-33-29(23-5-1-3-7-27(23)37-33)31(35(25)41)32-30-24-6-2-4-8-28(24)38-34(30)26(36(32)42)18-20-11-15-22(40)16-12-20/h1-18,39-40H |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 8188 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL507146 |
By LinkDB |
---|
By CAS RN | C083368 |
---|
class name | count |
---|
family name | count |
---|---|
Scytonemataceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Scytonema spp. | 1203 | Scytonemataceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P53350 | Serine/threonine-protein kinase PLK1 | PLK serine/threonine protein kinase subfamily | CHEMBL507146 |
CHEMBL985261
(1)
|
0 / 0 |