| id | C00045187 | 
|---|---|
| Name | 6-Bromoaplysinopsin | 
| CAS RN | 158991-92-5 | 
| Standard InChI | InChI=1S/C14H13BrN4O/c1-18-12(13(20)19(2)14(18)16)5-8-7-17-11-6-9(15)3-4-10(8)11/h3-7,16-17H,1-2H3/b12-5+,16-14? | 
| Standard InChI (Main Layer) | InChI=1S/C14H13BrN4O/c1-18-12(13(20)19(2)14(18)16)5-8-7-17-11-6-9(15)3-4-10(8)11/h3-7,16-17H,1-2H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3174 | 
| By standard InChI | CHEMBL463249 | 
|---|---|
| By standard InChI Main Layer | CHEMBL463249 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Thorectidae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Smenospongia aurea | 289409 | Thorectidae | Metazoa | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL463249 | CHEMBL2060937
                        (1) | 0 / 0 | 
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL463249 | CHEMBL2060936
                        (1) | 1 / 1 | 
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL463249 | CHEMBL1012214
                        (1)
                        CHEMBL1176400
                        (1) CHEMBL1176402 (1) | 0 / 0 | 
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL463249 | CHEMBL1012215
                        (1)
                        CHEMBL1176401
                        (1) CHEMBL1176403 (1) | 0 / 0 | 
| P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL463249 | CHEMBL1176399
                        (1) | 1 / 0 |