| id | C00045272 | 
|---|---|
| Name | Dadahol A / (+)-Dadahol A | 
| CAS RN | 405281-76-7 | 
| Standard InChI | InChI=1S/C39H38O12/c1-46-32-23-28(12-17-31(32)42)38(45)35(24-50-37(44)19-11-26-8-15-30(41)16-9-26)51-39-33(47-2)21-27(22-34(39)48-3)5-4-20-49-36(43)18-10-25-6-13-29(40)14-7-25/h4-19,21-23,35,38,40-42,45H,20,24H2,1-3H3/b5-4+,18-10+,19-11+/t35-,38+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C39H38O12/c1-46-32-23-28(12-17-31(32)42)38(45)35(24-50-37(44)19-11-26-8-15-30(41)16-9-26)51-39-33(47-2)21-27(22-34(39)48-3)5-4-20-49-36(43)18-10-25-6-13-29(40)14-7-25/h4-19,21-23,35,38,40-42,45H,20,24H2,1-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1214 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL501943 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Artocarpus dadah | 709041 | Moraceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL501943 | CHEMBL1020816
                        (1) | 0 / 3 | 
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL501943 | CHEMBL1020815
                        (1) | 0 / 0 |