| id | C00045328 |
|---|---|
| Name | Isoplysin A |
| CAS RN | 158761-04-7 |
| Standard InChI | InChI=1S/C14H14N4O/c1-15-14-17-13(19)12(18(14)2)7-9-8-16-11-6-4-3-5-10(9)11/h3-8,16H,1-2H3,(H,15,17,19)/b12-7+ |
| Standard InChI (Main Layer) | InChI=1S/C14H14N4O/c1-15-14-17-13(19)12(18(14)2)7-9-8-16-11-6-4-3-5-10(9)11/h3-8,16H,1-2H3,(H,15,17,19) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3174 |
| By standard InChI | CHEMBL508657 |
|---|---|
| By standard InChI Main Layer | CHEMBL508657 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Thorectidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Smenospongia aurea | 289409 | Thorectidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL508657 |
CHEMBL2060937
(1)
|
0 / 0 |
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL508657 |
CHEMBL2060936
(1)
|
1 / 1 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL508657 |
CHEMBL1012216
(1)
|
0 / 0 |
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL508657 |
CHEMBL1012217
(1)
|
0 / 0 |