| id | C00045334 |
|---|---|
| Name | Kynapcin 24 |
| CAS RN | 401918-16-9 |
| Standard InChI | InChI=1S/C20H14O10/c1-27-19(25)17-15(7-3-9(21)11(23)5-13(7)29-17)16-8-4-10(22)12(24)6-14(8)30-18(16)20(26)28-2/h3-6,21-24H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H14O10/c1-27-19(25)17-15(7-3-9(21)11(23)5-13(7)29-17)16-8-4-10(22)12(24)6-14(8)30-18(16)20(26)28-2/h3-6,21-24H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3516 |
| By standard InChI | CHEMBL465606 |
|---|---|
| By standard InChI Main Layer | CHEMBL465606 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Thelephoraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Polyozellus multiflex | 281718 | Thelephoraceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNI1 | Chymotrypsin-like elastase family member 1 | S1A | CHEMBL465606 |
CHEMBL1019928
(1)
CHEMBL1019929
(1)
CHEMBL1019939 (2) CHEMBL1020851 (1) |
0 / 0 |