| id | C00045359 |
|---|---|
| Name | N-Methyl 1,4-Dideoxy-1,4-imino-D-arabinitol |
| CAS RN | 117956-55-5 |
| Standard InChI | InChI=1S/C6H13NO3/c1-7-2-5(9)6(10)4(7)3-8/h4-6,8-10H,2-3H2,1H3/t4-,5-,6-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C6H13NO3/c1-7-2-5(9)6(10)4(7)3-8/h4-6,8-10H,2-3H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4946 |
| By standard InChI | CHEMBL80148 |
|---|---|
| By standard InChI Main Layer | CHEMBL80148 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Angylocalyx pynaertii | 149630 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O43451 | Maltase-glucoamylase, intestinal | Hydrolase | CHEMBL80148 |
CHEMBL710107
(1)
|
0 / 0 |