| id | C00045359 | 
|---|---|
| Name | N-Methyl 1,4-Dideoxy-1,4-imino-D-arabinitol | 
| CAS RN | 117956-55-5 | 
| Standard InChI | InChI=1S/C6H13NO3/c1-7-2-5(9)6(10)4(7)3-8/h4-6,8-10H,2-3H2,1H3/t4-,5-,6-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C6H13NO3/c1-7-2-5(9)6(10)4(7)3-8/h4-6,8-10H,2-3H2,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4946 | 
| By standard InChI | CHEMBL80148 | 
|---|---|
| By standard InChI Main Layer | CHEMBL80148 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Angylocalyx pynaertii | 149630 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| O43451 | Maltase-glucoamylase, intestinal | Hydrolase | CHEMBL80148 | CHEMBL710107
                        (1) | 0 / 0 |