| id | C00045360 | 
|---|---|
| Name | N-Methyl 1-Deoxymannojirimycin | 
| CAS RN | 96627-33-7 | 
| Standard InChI | InChI=1S/C7H15NO4/c1-8-2-5(10)7(12)6(11)4(8)3-9/h4-7,9-12H,2-3H2,1H3/t4-,5-,6-,7-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C7H15NO4/c1-8-2-5(10)7(12)6(11)4(8)3-9/h4-7,9-12H,2-3H2,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4946 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL418746 CHEMBL75971 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Angylocalyx pynaertii | 149630 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P49798 | Regulator of G-protein signaling 4 | Unclassified protein | CHEMBL418746 | CHEMBL1794499
                        (1) | 2 / 0 | 
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL418746 CHEMBL75971 | CHEMBL649344
                        (1)
                        CHEMBL822914
                        (1) CHEMBL822915 (1) | 1 / 1 | 
| P04066 | Tissue alpha-L-fucosidase | Enzyme | CHEMBL418746 | CHEMBL649586
                        (1) | 1 / 2 | 
| O43451 | Maltase-glucoamylase, intestinal | Hydrolase | CHEMBL75971 | CHEMBL710107
                        (1) | 0 / 0 |