| id | C00045437 |
|---|---|
| Name | Vidalenolone |
| CAS RN | 398475-98-4 |
| Standard InChI | InChI=1S/C13H14O4/c1-17-13(7-6-11(15)12(13)16)8-9-2-4-10(14)5-3-9/h2-6,14-15H,7-8H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C13H14O4/c1-17-13(7-6-11(15)12(13)16)8-9-2-4-10(14)5-3-9/h2-6,14-15H,7-8H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6215 |
| By standard InChI | CHEMBL465605 |
|---|---|
| By standard InChI Main Layer | CHEMBL465605 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Tephritidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Vidalia sp. | 472887 | Tephritidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00519 | Tyrosine-protein kinase ABL1 | Abl | CHEMBL465605 |
CHEMBL1019915
(1)
|
1 / 4 |
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL465605 |
CHEMBL1019914
(1)
|
0 / 0 |
| P46108 | Adapter molecule crk | Unclassified protein | CHEMBL465605 |
CHEMBL1019916
(1)
|
0 / 0 |
| P62993 | Growth factor receptor-bound protein 2 | Other cytosolic protein | CHEMBL465605 |
CHEMBL1019917
(1)
|
0 / 0 |