| id | C00045471 | 
|---|---|
| Name | (-)-Vaganine D | 
| CAS RN | 353228-46-3 | 
| Standard InChI | InChI=1S/C30H48N2O3/c1-18(2)17-27(34)31-26-14-16-30(6)24-13-15-29(5)22(19(3)32(7)8)11-12-23(29)21(24)9-10-25(30)28(26)35-20(4)33/h11,17,19,21,23-26,28H,9-10,12-16H2,1-8H3,(H,31,34)/t19-,21-,23-,24-,25-,26-,28+,29+,30+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C30H48N2O3/c1-18(2)17-27(34)31-26-14-16-30(6)24-13-15-29(5)22(19(3)32(7)8)11-12-23(29)21(24)9-10-25(30)28(26)35-20(4)33/h11,17,19,21,23-26,28H,9-10,12-16H2,1-8H3,(H,31,34) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1661 | 
| By standard InChI | CHEMBL460447 | 
|---|---|
| By standard InChI Main Layer | CHEMBL139630 CHEMBL460447 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| eudicotyledons | 1 | 
| family name | count | 
|---|---|
| Buxaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Sarcococca coriacea | 108422 | Buxaceae | eudicotyledons | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL139630 | CHEMBL641237
                        (1) | 1 / 0 |