| id | C00045471 |
|---|---|
| Name | (-)-Vaganine D |
| CAS RN | 353228-46-3 |
| Standard InChI | InChI=1S/C30H48N2O3/c1-18(2)17-27(34)31-26-14-16-30(6)24-13-15-29(5)22(19(3)32(7)8)11-12-23(29)21(24)9-10-25(30)28(26)35-20(4)33/h11,17,19,21,23-26,28H,9-10,12-16H2,1-8H3,(H,31,34)/t19-,21-,23-,24-,25-,26-,28+,29+,30+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H48N2O3/c1-18(2)17-27(34)31-26-14-16-30(6)24-13-15-29(5)22(19(3)32(7)8)11-12-23(29)21(24)9-10-25(30)28(26)35-20(4)33/h11,17,19,21,23-26,28H,9-10,12-16H2,1-8H3,(H,31,34) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1661 |
| By standard InChI | CHEMBL460447 |
|---|---|
| By standard InChI Main Layer | CHEMBL139630 CHEMBL460447 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Buxaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sarcococca coriacea | 108422 | Buxaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL139630 |
CHEMBL641237
(1)
|
1 / 0 |