| id | C00045486 |
|---|---|
| Name | (2S)-7,4'-Dihydroxy-3'-prenylflavan / (-)-(2S)-7,4'-Dihydroxy-3'-prenylflavan |
| CAS RN | 376361-96-5 |
| Standard InChI | InChI=1S/C20H22O3/c1-13(2)3-4-15-11-16(6-9-18(15)22)19-10-7-14-5-8-17(21)12-20(14)23-19/h3,5-6,8-9,11-12,19,21-22H,4,7,10H2,1-2H3/t19-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H22O3/c1-13(2)3-4-15-11-16(6-9-18(15)22)19-10-7-14-5-8-17(21)12-20(14)23-19/h3,5-6,8-9,11-12,19,21-22H,4,7,10H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3080 |
| By standard InChI | CHEMBL456062 |
|---|---|
| By standard InChI Main Layer | CHEMBL456062 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Broussonetia papyrifera | 172644 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL456062 |
CHEMBL949646
(1)
|
2 / 2 |