| id | C00045535 |
|---|---|
| Name | 2',3'-di-O-Acetylfrangulin A / (-)-2',3'-di-O-Acetylfrangulin A |
| CAS RN | 167696-53-9 |
| Standard InChI | InChI=1S/C25H24O11/c1-9-5-14-18(16(28)6-9)22(32)19-15(21(14)31)7-13(8-17(19)29)36-25-24(35-12(4)27)23(34-11(3)26)20(30)10(2)33-25/h5-8,10,20,23-25,28-30H,1-4H3/t10-,20-,23+,24+,25-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C25H24O11/c1-9-5-14-18(16(28)6-9)22(32)19-15(21(14)31)7-13(8-17(19)29)36-25-24(35-12(4)27)23(34-11(3)26)20(30)10(2)33-25/h5-8,10,20,23-25,28-30H,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3192 |
| By standard InChI | CHEMBL464290 |
|---|---|
| By standard InChI Main Layer | CHEMBL464290 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Rhamnaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Rhamnus nepalensis | 3609 | Rhamnaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL464290 |
CHEMBL1176797
(1)
|
0 / 0 |