id | C00045564 |
---|---|
Name | 3-Methoxysampangine |
CAS RN | 128129-42-0 |
Standard InChI | InChI=1S/C16H10N2O2/c1-20-12-8-18-14-9-4-2-3-5-10(9)16(19)15-13(14)11(12)6-7-17-15/h2-8H,1H3 |
Standard InChI (Main Layer) | InChI=1S/C16H10N2O2/c1-20-12-8-18-14-9-4-2-3-5-10(9)16(19)15-13(14)11(12)6-7-17-15/h2-8H,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1472 |
By standard InChI | CHEMBL335181 |
---|---|
By standard InChI Main Layer | CHEMBL335181 |
By LinkDB |
---|
By CAS RN | C064232 |
---|
class name | count |
---|---|
Magnoliophyta | 1 |
family name | count |
---|---|
Annonaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Duguetia hadrantha | 294152 | Annonaceae | Magnoliophyta | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P20701 | Integrin alpha-L | Membrane receptor | CHEMBL335181 |
CHEMBL945484
(1)
CHEMBL945487
(1)
|
0 / 0 |