| id | C00045670 |
|---|---|
| Name | Asperuloide A / (-)-Asperuloide A |
| CAS RN | 474081-27-1 |
| Standard InChI | InChI=1S/C27H38O13/c1-10-4-5-12-14(8-36-25(34)18(10)12)24(33)38-16-6-13-15(23(32)35-3)9-37-26(19(13)11(16)2)40-27-22(31)21(30)20(29)17(7-28)39-27/h9-14,16-22,26-31H,4-8H2,1-3H3/t10-,11-,12+,13+,14+,16-,17+,18+,19+,20+,21-,22+,26-,27-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H38O13/c1-10-4-5-12-14(8-36-25(34)18(10)12)24(33)38-16-6-13-15(23(32)35-3)9-37-26(19(13)11(16)2)40-27-22(31)21(30)20(29)17(7-28)39-27/h9-14,16-22,26-31H,4-8H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 389 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Asperula maximowiczii | 25003 | Rubiaceae | asterids | Viridiplantae |