| id | C00046020 |
|---|---|
| Name | Hyacinthacine B4 / (-)-Hyacinthacine B4 |
| CAS RN | 479348-19-1 |
| Standard InChI | InChI=1S/C9H17NO4/c1-4-2-6(12)7-9(14)8(13)5(3-11)10(4)7/h4-9,11-14H,2-3H2,1H3/t4-,5-,6+,7-,8-,9-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C9H17NO4/c1-4-2-6(12)7-9(14)8(13)5(3-11)10(4)7/h4-9,11-14H,2-3H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 753 |
| By standard InChI | CHEMBL523761 |
|---|---|
| By standard InChI Main Layer | CHEMBL437108 CHEMBL523761 CHEMBL497927 CHEMBL497935 CHEMBL524631 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Hyacinthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Scilla sibirica | 4701 | Hyacinthaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04066 | Tissue alpha-L-fucosidase | Enzyme | CHEMBL437108 |
CHEMBL906425
(1)
|
1 / 2 |