| id | C00046022 | 
|---|---|
| Name | Hyacinthacine B6 / (-)-Hyacinthacine B6 | 
| CAS RN | 479348-21-5 | 
| Standard InChI | InChI=1S/C9H17NO4/c1-4-2-6(12)7-9(14)8(13)5(3-11)10(4)7/h4-9,11-14H,2-3H2,1H3/t4-,5-,6+,7-,8+,9+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C9H17NO4/c1-4-2-6(12)7-9(14)8(13)5(3-11)10(4)7/h4-9,11-14H,2-3H2,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 753 | 
| By standard InChI | CHEMBL497935 | 
|---|---|
| By standard InChI Main Layer | CHEMBL437108 CHEMBL523761 CHEMBL497927 CHEMBL497935 CHEMBL524631 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 1 | 
| family name | count | 
|---|---|
| Hyacinthaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Scilla sibirica | 4701 | Hyacinthaceae | Liliopsida | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P04066 | Tissue alpha-L-fucosidase | Enzyme | CHEMBL437108 | CHEMBL906425
                        (1) | 1 / 2 |