| id | C00046225 |
|---|---|
| Name | O-Demethyl-buchenavianine |
| CAS RN | 91147-18-1 |
| Standard InChI | InChI=1S/C21H21NO4/c1-22-10-6-5-9-14(22)19-15(23)11-16(24)20-17(25)12-18(26-21(19)20)13-7-3-2-4-8-13/h2-4,7-8,11-12,14,23-24H,5-6,9-10H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H21NO4/c1-22-10-6-5-9-14(22)19-15(23)11-16(24)20-17(25)12-18(26-21(19)20)13-7-3-2-4-8-13/h2-4,7-8,11-12,14,23-24H,5-6,9-10H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2523 |
| By standard InChI | CHEMBL489967 |
|---|---|
| By standard InChI Main Layer | CHEMBL489967 CHEMBL2029614 CHEMBL2029615 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Combretaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Buchenavia capitata | 470568 | Combretaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q00535 | Cyclin-dependent kinase 5 | Cdk5 | CHEMBL489967 CHEMBL2029614 CHEMBL2029615 |
CHEMBL2032664
(3)
|
0 / 0 |
| Q15078 | Cyclin-dependent kinase 5 activator 1 | REG serine/threonine protein kinase family | CHEMBL489967 CHEMBL2029614 CHEMBL2029615 |
CHEMBL2032664
(3)
|
0 / 0 |