| id | C00046245 |
|---|---|
| Name | Ophiopogonone C |
| CAS RN | 477336-77-9 |
| Standard InChI | InChI=1S/C19H14O7/c1-9-16(21)12(6-20)19-15(17(9)22)18(23)11(7-24-19)4-10-2-3-13-14(5-10)26-8-25-13/h2-3,5-7,21-22H,4,8H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H14O7/c1-9-16(21)12(6-20)19-15(17(9)22)18(23)11(7-24-19)4-10-2-3-13-14(5-10)26-8-25-13/h2-3,5-7,21-22H,4,8H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5151 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Asparagaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Ophiopogon japonicus | 100506 | Asparagaceae | Liliopsida | Viridiplantae |