| id | C00046335 |
|---|---|
| Name | Purpuramine I |
| CAS RN | 149637-00-3 |
| Standard InChI | InChI=1S/C22H26Br3N3O4/c1-26-7-3-9-32-21-17(24)11-15(12-18(21)25)6-8-27-22(29)19(28-30)13-14-4-5-20(31-2)16(23)10-14/h4-5,10-12,26,30H,3,6-9,13H2,1-2H3,(H,27,29)/b28-19+ |
| Standard InChI (Main Layer) | InChI=1S/C22H26Br3N3O4/c1-26-7-3-9-32-21-17(24)11-15(12-18(21)25)6-8-27-22(29)19(28-30)13-14-4-5-20(31-2)16(23)10-14/h4-5,10-12,26,30H,3,6-9,13H2,1-2H3,(H,27,29) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 832 |
| By standard InChI | CHEMBL465039 |
|---|---|
| By standard InChI Main Layer | CHEMBL465039 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Suberea sp. |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q12778 | Forkhead box protein O1 | Unclassified protein | CHEMBL465039 |
CHEMBL972962
(1)
|
1 / 2 |