| id | C00046373 |
|---|---|
| Name | Sampangine |
| CAS RN | 116664-93-8 |
| Standard InChI | InChI=1S/C15H8N2O/c18-15-11-4-2-1-3-10(11)13-12-9(5-7-16-13)6-8-17-14(12)15/h1-8H |
| Standard InChI (Main Layer) | InChI=1S/C15H8N2O/c18-15-11-4-2-1-3-10(11)13-12-9(5-7-16-13)6-8-17-14(12)15/h1-8H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1472 |
| By standard InChI | CHEMBL435201 |
|---|---|
| By standard InChI Main Layer | CHEMBL435201 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Annonaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Duguetia hadrantha | 294152 | Annonaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P20701 | Integrin alpha-L | Membrane receptor | CHEMBL435201 |
CHEMBL945484
(1)
CHEMBL945487
(1)
|
0 / 0 |