| id | C00004672 |
|---|---|
| Name | Eriostemin |
| CAS RN | 40522-42-7 |
| Standard InChI | InChI=1S/C19H18O8/c1-23-10-7-5-9(6-8-10)15-13(21)12(20)11-16(27-15)14(22)18(25-3)19(26-4)17(11)24-2/h5-8,21-22H,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H18O8/c1-23-10-7-5-9(6-8-10)15-13(21)12(20)11-16(27-15)14(22)18(25-3)19(26-4)17(11)24-2/h5-8,21-22H,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eriostemon buxifolia | 68541 | Rutaceae | rosids | Viridiplantae |
| Eriostemon buxifolius | 68541 | Rutaceae | rosids | Viridiplantae |
| Eriostemon hispidulus | 68541 | Rutaceae | rosids | Viridiplantae |