| id | C00004685 |
|---|---|
| Name | Tomentin / 3,7-Dimethylquercetagetin / 5,6,3',4'-Tetrahydroxy-3,7-dimethoxyflavone / 2-(3,4-Dihydroxyphenyl)-5,6-dihydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| CAS RN | 59171-23-2 |
| Standard InChI | InChI=1S/C17H14O8/c1-23-11-6-10-12(14(21)13(11)20)15(22)17(24-2)16(25-10)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O8/c1-23-11-6-10-12(14(21)13(11)20)15(22)17(24-2)16(25-10)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL485677 |
|---|---|
| By standard InChI Main Layer | CHEMBL485677 |
| By LinkDB | C04581 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 14 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Asteraceae | 12 |
| Hydrophyllaceae | 1 |
| Saxifragaceae | 1 |
| Apocynaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P15121 | Aldose reductase | Enzyme | CHEMBL485677 |
CHEMBL1036011
(1)
CHEMBL1036012
(1)
CHEMBL1036013 (1) CHEMBL1036014 (1) |
0 / 0 |