| id | C00047165 |
|---|---|
| Name | Alstiphyllanine A / (-)-Alstiphyllanine A |
| CAS RN | 1124378-30-8 |
| Standard InChI | InChI=1S/C24H28N2O5/c1-5-14-12-26(29)18-10-16(14)24(22(28)30-4)19(26)11-23(21(24)31-13(2)27)15-8-6-7-9-17(15)25(3)20(18)23/h5-9,16,18-21H,10-12H2,1-4H3/b14-5+/t16?,18-,19-,20+,21-,23+,24?,26?/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C24H28N2O5/c1-5-14-12-26(29)18-10-16(14)24(22(28)30-4)19(26)11-23(21(24)31-13(2)27)15-8-6-7-9-17(15)25(3)20(18)23/h5-9,16,18-21H,10-12H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 507 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL564606 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Apocynaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alstonia macrophylla | 693366 | Apocynaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL564606 |
CHEMBL1070175
(1)
|
1 / 1 |
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL564606 |
CHEMBL1070176
(1)
|
1 / 1 |