| id | C00047327 |
|---|---|
| Name | Omuralide / (-)-Omuralide |
| CAS RN | 154226-60-5 |
| Standard InChI | InChI=1S/C10H15NO4/c1-4(2)6(12)10-7(15-9(10)14)5(3)8(13)11-10/h4-7,12H,1-3H3,(H,11,13)/t5-,6+,7+,10?/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H15NO4/c1-4(2)6(12)10-7(15-9(10)14)5(3)8(13)11-10/h4-7,12H,1-3H3,(H,11,13) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8394 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL381627 CHEMBL490829 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Micromonosporaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Salinispora tropica | 168695 | Micromonosporaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P49721 | Proteasome subunit beta type-2 | T1A | CHEMBL490829 |
CHEMBL1007984
(1)
|
0 / 0 |
| P28074 | Proteasome subunit beta type-5 | T1A | CHEMBL490829 |
CHEMBL1007983
(1)
|
0 / 0 |