| id | C00047392 |
|---|---|
| Name | Arteminorin C |
| CAS RN | 1158294-47-3 |
| Standard InChI | InChI=1S/C20H14O9/c1-26-15-6-9-4-11(20(25)29-17(9)18(27-2)16(15)23)10-3-8-5-12(21)13(22)7-14(8)28-19(10)24/h3-7,21-23H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H14O9/c1-26-15-6-9-4-11(20(25)29-17(9)18(27-2)16(15)23)10-3-8-5-12(21)13(22)7-14(8)28-19(10)24/h3-7,21-23H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1364 |
| By standard InChI | CHEMBL1085430 |
|---|---|
| By standard InChI Main Layer | CHEMBL1085430 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artemisia minor | 1227633 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL1085430 |
CHEMBL1101617
(1)
|
1 / 1 |