| id | C00047490 |
|---|---|
| Name | Leptoclinidamine B / (+)-Leptoclinidamine B |
| CAS RN | 1132757-94-8 |
| Standard InChI | InChI=1S/C16H19N5O5/c17-16(18)19-5-1-2-11(15(25)26)21-14(24)13(23)10-7-20-12-6-8(22)3-4-9(10)12/h3-4,6-7,11,20,22H,1-2,5H2,(H,21,24)(H,25,26)(H4,17,18,19)/t11-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H19N5O5/c17-16(18)19-5-1-2-11(15(25)26)21-14(24)13(23)10-7-20-12-6-8(22)3-4-9(10)12/h3-4,6-7,11,20,22H,1-2,5H2,(H,21,24)(H,25,26)(H4,17,18,19) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5387 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL2208197 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Didemnidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Leptoclinides durus | 322841 | Didemnidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL2208197 |
CHEMBL2213781
(1)
CHEMBL2213782
(1)
|
5 / 3 |