| id | C00047524 |
|---|---|
| Name | Neoselaginellic acid / (-)-Neoselaginellic acid |
| CAS RN | 1158820-19-9 |
| Standard InChI | InChI=1S/C18H24N2O3/c1-13(16(21)22)9-10-18(11-12-20(4)17(18)23)14-7-5-6-8-15(14)19(2)3/h5-9H,10-12H2,1-4H3,(H,21,22)/b13-9+/t18-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H24N2O3/c1-13(16(21)22)9-10-18(11-12-20(4)17(18)23)14-7-5-6-8-15(14)19(2)3/h5-9H,10-12H2,1-4H3,(H,21,22) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7452 |
| By standard InChI | CHEMBL564690 |
|---|---|
| By standard InChI Main Layer | CHEMBL564690 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Embryophyta | 1 |
| family name | count |
|---|---|
| Selaginellaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Selaginella moellendorfii | 88036 | Selaginellaceae | Embryophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL564690 |
CHEMBL1058102
(1)
|
1 / 0 |