| id | C00047700 |
|---|---|
| Name | Aerophobin 1 |
| CAS RN | 87075-24-9 |
| Standard InChI | InChI=1S/C15H16Br2N4O4/c1-24-12-9(16)4-15(13(22)11(12)17)5-10(21-25-15)14(23)19-3-2-8-6-18-7-20-8/h4,6-7,13,22H,2-3,5H2,1H3,(H,18,20)(H,19,23)/t13-,15+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H16Br2N4O4/c1-24-12-9(16)4-15(13(22)11(12)17)5-10(21-25-15)14(23)19-3-2-8-6-18-7-20-8/h4,6-7,13,22H,2-3,5H2,1H3,(H,18,20)(H,19,23) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4817 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL499178 CHEMBL479515 |
| By LinkDB | C17162 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aplysinellidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Suberea clavata | 1162767 | Aplysinellidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P03951 | Coagulation factor XI | S1A | CHEMBL499178 |
CHEMBL1057765
(1)
|
1 / 1 |
| P00740 | Coagulation factor IX | S1A | CHEMBL499178 |
CHEMBL1057766
(1)
|
2 / 2 |