| id | C00047707 |
|---|---|
| Name | Alstoyunine A |
| CAS RN | 1188932-11-7 |
| Standard InChI | InChI=1S/C20H24N2O3/c1-9-16-12-8-15-18-11(10-5-3-4-6-13(10)21-18)7-14(22(9)15)17(12)19(23)25-20(16)24-2/h3-6,9,12,14-17,19-21,23H,7-8H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H24N2O3/c1-9-16-12-8-15-18-11(10-5-3-4-6-13(10)21-18)7-14(22(9)15)17(12)19(23)25-20(16)24-2/h3-6,9,12,14-17,19-21,23H,7-8H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5529 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1079511 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Apocynaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alstonia yunnanensis | 52821 | Apocynaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P09917 | Arachidonate 5-lipoxygenase | Oxidoreductase | CHEMBL1079511 |
CHEMBL1110263
(1)
|
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL1079511 |
CHEMBL1110262
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL1079511 |
CHEMBL1110261
(1)
|
0 / 0 |